About 3-cyclohexylpropan-1-ol;methanesulfonic acid
3-cyclohexylpropan-1-ol;methanesulfonic acid (PubChem CID 71346347) has the molecular formula C10H22O4S
and a molecular weight of 238.35 g/mol. Its IUPAC name is 3-cyclohexylpropan-1-ol;methanesulfonic acid.
Molecular Properties
| Compound Name | 3-cyclohexylpropan-1-ol;methanesulfonic acid |
| PubChem CID | 71346347 |
| Molecular Formula | C10H22O4S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 3-cyclohexylpropan-1-ol;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.OCCCC1CCCCC1 |
| InChI | InChI=1S/C9H18O.CH4O3S/c10-8-4-7-9-5-2-1-3-6-9;1-5(2,3)4/h9-10H,1-8H2;1H3,(H,2,3,4) |
| InChIKey | QSBGMWAKJVUBEI-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclohexylpropan-1-ol;methanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexylpropan-1-ol;methanesulfonic acid?
The IUPAC name of 3-cyclohexylpropan-1-ol;methanesulfonic acid (CID 71346347) is 3-cyclohexylpropan-1-ol;methanesulfonic acid.
What is the SMILES notation for 3-cyclohexylpropan-1-ol;methanesulfonic acid?
The canonical SMILES for 3-cyclohexylpropan-1-ol;methanesulfonic acid is CS(=O)(=O)O.OCCCC1CCCCC1.
What is the InChIKey of 3-cyclohexylpropan-1-ol;methanesulfonic acid?
The InChIKey is QSBGMWAKJVUBEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O.CH4O3S/c10-8-4-7-9-5-2-1-3-6-9;1-5(2,3)4/h9-10H,1-8H2;1H3,(H,2,3,4).
What are the key properties of 3-cyclohexylpropan-1-ol;methanesulfonic acid?
3-cyclohexylpropan-1-ol;methanesulfonic acid has a molecular weight of 238.35 g/mol, XLogP of 1.84, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexylpropan-1-ol;methanesulfonic acid is sourced from PubChem (CID 71346347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).