About 3,5-bis(bromomethyl)-2,6-diphenylpyran-4-one
3,5-bis(bromomethyl)-2,6-diphenylpyran-4-one (PubChem CID 71346571) has the molecular formula C19H14Br2O2
and a molecular weight of 434.13 g/mol. Its IUPAC name is 3,5-bis(bromomethyl)-2,6-diphenylpyran-4-one.
Molecular Properties
| Compound Name | 3,5-bis(bromomethyl)-2,6-diphenylpyran-4-one |
| PubChem CID | 71346571 |
| Molecular Formula | C19H14Br2O2 |
| Molecular Weight | 434.13 g/mol |
| Exact Mass | 431.94 |
| IUPAC Name | 3,5-bis(bromomethyl)-2,6-diphenylpyran-4-one |
| SMILES | O=c1c(CBr)c(-c2ccccc2)oc(-c2ccccc2)c1CBr |
| InChI | InChI=1S/C19H14Br2O2/c20-11-15-17(22)16(12-21)19(14-9-5-2-6-10-14)23-18(15)13-7-3-1-4-8-13/h1-10H,11-12H2 |
| InChIKey | PCNXWTXETZXIAZ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.13 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3,5-bis(bromomethyl)-2,6-diphenylpyran-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-bis(bromomethyl)-2,6-diphenylpyran-4-one?
The IUPAC name of 3,5-bis(bromomethyl)-2,6-diphenylpyran-4-one (CID 71346571) is 3,5-bis(bromomethyl)-2,6-diphenylpyran-4-one.
What is the SMILES notation for 3,5-bis(bromomethyl)-2,6-diphenylpyran-4-one?
The canonical SMILES for 3,5-bis(bromomethyl)-2,6-diphenylpyran-4-one is O=c1c(CBr)c(-c2ccccc2)oc(-c2ccccc2)c1CBr.
What is the InChIKey of 3,5-bis(bromomethyl)-2,6-diphenylpyran-4-one?
The InChIKey is PCNXWTXETZXIAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14Br2O2/c20-11-15-17(22)16(12-21)19(14-9-5-2-6-10-14)23-18(15)13-7-3-1-4-8-13/h1-10H,11-12H2.
What are the key properties of 3,5-bis(bromomethyl)-2,6-diphenylpyran-4-one?
3,5-bis(bromomethyl)-2,6-diphenylpyran-4-one has a molecular weight of 434.13 g/mol, XLogP of 5.76, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-bis(bromomethyl)-2,6-diphenylpyran-4-one is sourced from PubChem (CID 71346571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).