About 5-(hydroxymethylidene)-6,7-dihydro-1-benzothiophen-4-one
5-(hydroxymethylidene)-6,7-dihydro-1-benzothiophen-4-one (PubChem CID 71346768) has the molecular formula C9H8O2S
and a molecular weight of 180.23 g/mol. Its IUPAC name is 5-(hydroxymethylidene)-6,7-dihydro-1-benzothiophen-4-one.
Molecular Properties
| Compound Name | 5-(hydroxymethylidene)-6,7-dihydro-1-benzothiophen-4-one |
| PubChem CID | 71346768 |
| Molecular Formula | C9H8O2S |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.02 |
| IUPAC Name | 5-(hydroxymethylidene)-6,7-dihydro-1-benzothiophen-4-one |
| SMILES | O=C1C(=CO)CCc2sccc21 |
| InChI | InChI=1S/C9H8O2S/c10-5-6-1-2-8-7(9(6)11)3-4-12-8/h3-5,10H,1-2H2 |
| InChIKey | NHSJDWXBEAAPQT-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-(hydroxymethylidene)-6,7-dihydro-1-benzothiophen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(hydroxymethylidene)-6,7-dihydro-1-benzothiophen-4-one?
The IUPAC name of 5-(hydroxymethylidene)-6,7-dihydro-1-benzothiophen-4-one (CID 71346768) is 5-(hydroxymethylidene)-6,7-dihydro-1-benzothiophen-4-one.
What is the SMILES notation for 5-(hydroxymethylidene)-6,7-dihydro-1-benzothiophen-4-one?
The canonical SMILES for 5-(hydroxymethylidene)-6,7-dihydro-1-benzothiophen-4-one is O=C1C(=CO)CCc2sccc21.
What is the InChIKey of 5-(hydroxymethylidene)-6,7-dihydro-1-benzothiophen-4-one?
The InChIKey is NHSJDWXBEAAPQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O2S/c10-5-6-1-2-8-7(9(6)11)3-4-12-8/h3-5,10H,1-2H2.
What are the key properties of 5-(hydroxymethylidene)-6,7-dihydro-1-benzothiophen-4-one?
5-(hydroxymethylidene)-6,7-dihydro-1-benzothiophen-4-one has a molecular weight of 180.23 g/mol, XLogP of 2.32, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(hydroxymethylidene)-6,7-dihydro-1-benzothiophen-4-one is sourced from PubChem (CID 71346768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).