About methyl 5,9-dimethyldeca-4,8-dienoate
methyl 5,9-dimethyldeca-4,8-dienoate (PubChem CID 71346793) has the molecular formula C13H22O2
and a molecular weight of 210.32 g/mol. Its IUPAC name is methyl 5,9-dimethyldeca-4,8-dienoate.
Molecular Properties
| Compound Name | methyl 5,9-dimethyldeca-4,8-dienoate |
| PubChem CID | 71346793 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | methyl 5,9-dimethyldeca-4,8-dienoate |
| SMILES | COC(=O)CCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C13H22O2/c1-11(2)7-5-8-12(3)9-6-10-13(14)15-4/h7,9H,5-6,8,10H2,1-4H3 |
| InChIKey | AVFLRLAFBQUJGG-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 5,9-dimethyldeca-4,8-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5,9-dimethyldeca-4,8-dienoate?
The IUPAC name of methyl 5,9-dimethyldeca-4,8-dienoate (CID 71346793) is methyl 5,9-dimethyldeca-4,8-dienoate.
What is the SMILES notation for methyl 5,9-dimethyldeca-4,8-dienoate?
The canonical SMILES for methyl 5,9-dimethyldeca-4,8-dienoate is COC(=O)CCC=C(C)CCC=C(C)C.
What is the InChIKey of methyl 5,9-dimethyldeca-4,8-dienoate?
The InChIKey is AVFLRLAFBQUJGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O2/c1-11(2)7-5-8-12(3)9-6-10-13(14)15-4/h7,9H,5-6,8,10H2,1-4H3.
What are the key properties of methyl 5,9-dimethyldeca-4,8-dienoate?
methyl 5,9-dimethyldeca-4,8-dienoate has a molecular weight of 210.32 g/mol, XLogP of 3.63, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5,9-dimethyldeca-4,8-dienoate is sourced from PubChem (CID 71346793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).