About [(2S)-1-(4-bromohexa-2,4-dienyl)pyrrolidin-2-yl]methanol
[(2S)-1-(4-bromohexa-2,4-dienyl)pyrrolidin-2-yl]methanol (PubChem CID 71346893) has the molecular formula C11H18BrNO
and a molecular weight of 260.17 g/mol. Its IUPAC name is [(2S)-1-(4-bromohexa-2,4-dienyl)pyrrolidin-2-yl]methanol.
Molecular Properties
| Compound Name | [(2S)-1-(4-bromohexa-2,4-dienyl)pyrrolidin-2-yl]methanol |
| PubChem CID | 71346893 |
| Molecular Formula | C11H18BrNO |
| Molecular Weight | 260.17 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | [(2S)-1-(4-bromohexa-2,4-dienyl)pyrrolidin-2-yl]methanol |
| SMILES | CC=C(Br)C=CCN1CCC[C@H]1CO |
| InChI | InChI=1S/C11H18BrNO/c1-2-10(12)5-3-7-13-8-4-6-11(13)9-14/h2-3,5,11,14H,4,6-9H2,1H3/t11-/m0/s1 |
| InChIKey | XJCMZEXQHMQBLT-NSHDSACASA-N |
| XLogP | 2.30 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.17 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-1-(4-bromohexa-2,4-dienyl)pyrrolidin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-1-(4-bromohexa-2,4-dienyl)pyrrolidin-2-yl]methanol?
The IUPAC name of [(2S)-1-(4-bromohexa-2,4-dienyl)pyrrolidin-2-yl]methanol (CID 71346893) is [(2S)-1-(4-bromohexa-2,4-dienyl)pyrrolidin-2-yl]methanol.
What is the SMILES notation for [(2S)-1-(4-bromohexa-2,4-dienyl)pyrrolidin-2-yl]methanol?
The canonical SMILES for [(2S)-1-(4-bromohexa-2,4-dienyl)pyrrolidin-2-yl]methanol is CC=C(Br)C=CCN1CCC[C@H]1CO.
What is the InChIKey of [(2S)-1-(4-bromohexa-2,4-dienyl)pyrrolidin-2-yl]methanol?
The InChIKey is XJCMZEXQHMQBLT-NSHDSACASA-N. The full InChI is InChI=1S/C11H18BrNO/c1-2-10(12)5-3-7-13-8-4-6-11(13)9-14/h2-3,5,11,14H,4,6-9H2,1H3/t11-/m0/s1.
What are the key properties of [(2S)-1-(4-bromohexa-2,4-dienyl)pyrrolidin-2-yl]methanol?
[(2S)-1-(4-bromohexa-2,4-dienyl)pyrrolidin-2-yl]methanol has a molecular weight of 260.17 g/mol, XLogP of 2.30, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-1-(4-bromohexa-2,4-dienyl)pyrrolidin-2-yl]methanol is sourced from PubChem (CID 71346893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).