About perylene;hydrate
perylene;hydrate (PubChem CID 71346967) has the molecular formula C20H14O
and a molecular weight of 270.33 g/mol. Its IUPAC name is perylene;hydrate.
Molecular Properties
| Compound Name | perylene;hydrate |
| PubChem CID | 71346967 |
| Molecular Formula | C20H14O |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | perylene;hydrate |
| SMILES | O.c1cc2cccc3c4cccc5cccc(c(c1)c23)c54 |
| InChI | InChI=1S/C20H12.H2O/c1-5-13-6-2-11-17-18-12-4-8-14-7-3-10-16(20(14)18)15(9-1)19(13)17;/h1-12H;1H2 |
| InChIKey | XOEXCUULVHWLKI-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 31.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze perylene;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of perylene;hydrate?
The IUPAC name of perylene;hydrate (CID 71346967) is perylene;hydrate.
What is the SMILES notation for perylene;hydrate?
The canonical SMILES for perylene;hydrate is O.c1cc2cccc3c4cccc5cccc(c(c1)c23)c54.
What is the InChIKey of perylene;hydrate?
The InChIKey is XOEXCUULVHWLKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12.H2O/c1-5-13-6-2-11-17-18-12-4-8-14-7-3-10-16(20(14)18)15(9-1)19(13)17;/h1-12H;1H2.
What are the key properties of perylene;hydrate?
perylene;hydrate has a molecular weight of 270.33 g/mol, XLogP of 4.91, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for perylene;hydrate is sourced from PubChem (CID 71346967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).