About 3-tert-butyl-5-phenyl-3H-1,2,4-diselenazole
3-tert-butyl-5-phenyl-3H-1,2,4-diselenazole (PubChem CID 71346981) has the molecular formula C12H15NSe2
and a molecular weight of 331.18 g/mol. Its IUPAC name is 3-tert-butyl-5-phenyl-3H-1,2,4-diselenazole.
Molecular Properties
| Compound Name | 3-tert-butyl-5-phenyl-3H-1,2,4-diselenazole |
| PubChem CID | 71346981 |
| Molecular Formula | C12H15NSe2 |
| Molecular Weight | 331.18 g/mol |
| Exact Mass | 332.95 |
| IUPAC Name | 3-tert-butyl-5-phenyl-3H-1,2,4-diselenazole |
| SMILES | CC(C)(C)C1N=C(c2ccccc2)[Se][Se]1 |
| InChI | InChI=1S/C12H15NSe2/c1-12(2,3)11-13-10(14-15-11)9-7-5-4-6-8-9/h4-8,11H,1-3H3 |
| InChIKey | FRWUUXMVKSMHFD-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.18 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-tert-butyl-5-phenyl-3H-1,2,4-diselenazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-5-phenyl-3H-1,2,4-diselenazole?
The IUPAC name of 3-tert-butyl-5-phenyl-3H-1,2,4-diselenazole (CID 71346981) is 3-tert-butyl-5-phenyl-3H-1,2,4-diselenazole.
What is the SMILES notation for 3-tert-butyl-5-phenyl-3H-1,2,4-diselenazole?
The canonical SMILES for 3-tert-butyl-5-phenyl-3H-1,2,4-diselenazole is CC(C)(C)C1N=C(c2ccccc2)[Se][Se]1.
What is the InChIKey of 3-tert-butyl-5-phenyl-3H-1,2,4-diselenazole?
The InChIKey is FRWUUXMVKSMHFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NSe2/c1-12(2,3)11-13-10(14-15-11)9-7-5-4-6-8-9/h4-8,11H,1-3H3.
What are the key properties of 3-tert-butyl-5-phenyl-3H-1,2,4-diselenazole?
3-tert-butyl-5-phenyl-3H-1,2,4-diselenazole has a molecular weight of 331.18 g/mol, XLogP of 2.14, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-5-phenyl-3H-1,2,4-diselenazole is sourced from PubChem (CID 71346981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).