About didecyl (4-nitrophenyl) phosphate
didecyl (4-nitrophenyl) phosphate (PubChem CID 71347067) has the molecular formula C26H46NO6P
and a molecular weight of 499.63 g/mol. Its IUPAC name is didecyl (4-nitrophenyl) phosphate.
Molecular Properties
| Compound Name | didecyl (4-nitrophenyl) phosphate |
| PubChem CID | 71347067 |
| Molecular Formula | C26H46NO6P |
| Molecular Weight | 499.63 g/mol |
| Exact Mass | 499.31 |
| IUPAC Name | didecyl (4-nitrophenyl) phosphate |
| SMILES | CCCCCCCCCCOP(=O)(OCCCCCCCCCC)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H46NO6P/c1-3-5-7-9-11-13-15-17-23-31-34(30,32-24-18-16-14-12-10-8-6-4-2)33-26-21-19-25(20-22-26)27(28)29/h19-22H,3-18,23-24H2,1-2H3 |
| InChIKey | GOVBSCLWGZFXEM-UHFFFAOYSA-N |
| XLogP | 9.40 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 499.63 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze didecyl (4-nitrophenyl) phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of didecyl (4-nitrophenyl) phosphate?
The IUPAC name of didecyl (4-nitrophenyl) phosphate (CID 71347067) is didecyl (4-nitrophenyl) phosphate.
What is the SMILES notation for didecyl (4-nitrophenyl) phosphate?
The canonical SMILES for didecyl (4-nitrophenyl) phosphate is CCCCCCCCCCOP(=O)(OCCCCCCCCCC)Oc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of didecyl (4-nitrophenyl) phosphate?
The InChIKey is GOVBSCLWGZFXEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H46NO6P/c1-3-5-7-9-11-13-15-17-23-31-34(30,32-24-18-16-14-12-10-8-6-4-2)33-26-21-19-25(20-22-26)27(28)29/h19-22H,3-18,23-24H2,1-2H3.
What are the key properties of didecyl (4-nitrophenyl) phosphate?
didecyl (4-nitrophenyl) phosphate has a molecular weight of 499.63 g/mol, XLogP of 9.40, 23 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for didecyl (4-nitrophenyl) phosphate is sourced from PubChem (CID 71347067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).