C18H20O7S — CID 71347119
benzoic acid;but-2-yne-1,4-diol;4-methylbenzenesulfonic acid (PubChem CID 71347119) has the molecular formula C18H20O7S and a molecular weight of 380.42 g/mol. Its IUPAC name is benzoic acid;but-2-yne-1,4-diol;4-methylbenzenesulfonic acid.
| Compound Name | benzoic acid;but-2-yne-1,4-diol;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 71347119 |
| Molecular Formula | C18H20O7S |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | benzoic acid;but-2-yne-1,4-diol;4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.O=C(O)c1ccccc1.OCC#CCO |
| InChI | InChI=1S/C7H8O3S.C7H6O2.C4H6O2/c1-6-2-4-7(5-3-6)11(8,9)10;8-7(9)6-4-2-1-3-5-6;5-3-1-2-4-6/h2-5H,1H3,(H,8,9,10);1-5H,(H,8,9);5-6H,3-4H2 |
| InChIKey | KIRIBHPAEPRMOF-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|