About 2,4-bis(4-methoxyphenyl)-2,3-dihydropyran-6-one
2,4-bis(4-methoxyphenyl)-2,3-dihydropyran-6-one (PubChem CID 71347213) has the molecular formula C19H18O4
and a molecular weight of 310.35 g/mol. Its IUPAC name is 2,4-bis(4-methoxyphenyl)-2,3-dihydropyran-6-one.
Molecular Properties
| Compound Name | 2,4-bis(4-methoxyphenyl)-2,3-dihydropyran-6-one |
| PubChem CID | 71347213 |
| Molecular Formula | C19H18O4 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 2,4-bis(4-methoxyphenyl)-2,3-dihydropyran-6-one |
| SMILES | COc1ccc(C2=CC(=O)OC(c3ccc(OC)cc3)C2)cc1 |
| InChI | InChI=1S/C19H18O4/c1-21-16-7-3-13(4-8-16)15-11-18(23-19(20)12-15)14-5-9-17(22-2)10-6-14/h3-10,12,18H,11H2,1-2H3 |
| InChIKey | HPYPPPQFWSSUGW-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,4-bis(4-methoxyphenyl)-2,3-dihydropyran-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-bis(4-methoxyphenyl)-2,3-dihydropyran-6-one?
The IUPAC name of 2,4-bis(4-methoxyphenyl)-2,3-dihydropyran-6-one (CID 71347213) is 2,4-bis(4-methoxyphenyl)-2,3-dihydropyran-6-one.
What is the SMILES notation for 2,4-bis(4-methoxyphenyl)-2,3-dihydropyran-6-one?
The canonical SMILES for 2,4-bis(4-methoxyphenyl)-2,3-dihydropyran-6-one is COc1ccc(C2=CC(=O)OC(c3ccc(OC)cc3)C2)cc1.
What is the InChIKey of 2,4-bis(4-methoxyphenyl)-2,3-dihydropyran-6-one?
The InChIKey is HPYPPPQFWSSUGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18O4/c1-21-16-7-3-13(4-8-16)15-11-18(23-19(20)12-15)14-5-9-17(22-2)10-6-14/h3-10,12,18H,11H2,1-2H3.
What are the key properties of 2,4-bis(4-methoxyphenyl)-2,3-dihydropyran-6-one?
2,4-bis(4-methoxyphenyl)-2,3-dihydropyran-6-one has a molecular weight of 310.35 g/mol, XLogP of 3.78, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-bis(4-methoxyphenyl)-2,3-dihydropyran-6-one is sourced from PubChem (CID 71347213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).