C15H11Cl2N5 — CID 71347491
[5,6-bis(4-chlorophenyl)-1,2,4-triazin-3-yl]hydrazine (PubChem CID 71347491) has the molecular formula C15H11Cl2N5 and a molecular weight of 332.19 g/mol. Its IUPAC name is [5,6-bis(4-chlorophenyl)-1,2,4-triazin-3-yl]hydrazine.
| Compound Name | [5,6-bis(4-chlorophenyl)-1,2,4-triazin-3-yl]hydrazine |
|---|---|
| PubChem CID | 71347491 |
| Molecular Formula | C15H11Cl2N5 |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | [5,6-bis(4-chlorophenyl)-1,2,4-triazin-3-yl]hydrazine |
| SMILES | NNc1nnc(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C15H11Cl2N5/c16-11-5-1-9(2-6-11)13-14(21-22-15(19-13)20-18)10-3-7-12(17)8-4-10/h1-8H,18H2,(H,19,20,22) |
| InChIKey | OKVDLKSQZJUZHJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|