About bis(2,3,3-trimethylbutan-2-ol);hydrate
bis(2,3,3-trimethylbutan-2-ol);hydrate (PubChem CID 71347639) has the molecular formula C14H34O3
and a molecular weight of 250.42 g/mol. Its IUPAC name is bis(2,3,3-trimethylbutan-2-ol);hydrate.
Molecular Properties
| Compound Name | bis(2,3,3-trimethylbutan-2-ol);hydrate |
| PubChem CID | 71347639 |
| Molecular Formula | C14H34O3 |
| Molecular Weight | 250.42 g/mol |
| Exact Mass | 250.25 |
| IUPAC Name | bis(2,3,3-trimethylbutan-2-ol);hydrate |
| SMILES | CC(C)(C)C(C)(C)O.CC(C)(C)C(C)(C)O.O |
| InChI | InChI=1S/2C7H16O.H2O/c2*1-6(2,3)7(4,5)8;/h2*8H,1-5H3;1H2 |
| InChIKey | BBTQUAPFQAHORQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bis(2,3,3-trimethylbutan-2-ol);hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2,3,3-trimethylbutan-2-ol);hydrate?
The IUPAC name of bis(2,3,3-trimethylbutan-2-ol);hydrate (CID 71347639) is bis(2,3,3-trimethylbutan-2-ol);hydrate.
What is the SMILES notation for bis(2,3,3-trimethylbutan-2-ol);hydrate?
The canonical SMILES for bis(2,3,3-trimethylbutan-2-ol);hydrate is CC(C)(C)C(C)(C)O.CC(C)(C)C(C)(C)O.O.
What is the InChIKey of bis(2,3,3-trimethylbutan-2-ol);hydrate?
The InChIKey is BBTQUAPFQAHORQ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H16O.H2O/c2*1-6(2,3)7(4,5)8;/h2*8H,1-5H3;1H2.
What are the key properties of bis(2,3,3-trimethylbutan-2-ol);hydrate?
bis(2,3,3-trimethylbutan-2-ol);hydrate has a molecular weight of 250.42 g/mol, XLogP of 2.78, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2,3,3-trimethylbutan-2-ol);hydrate is sourced from PubChem (CID 71347639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).