About 2,3-dimethylidene-1,4-dihydropyrazine
2,3-dimethylidene-1,4-dihydropyrazine (PubChem CID 71347911) has the molecular formula C6H8N2
and a molecular weight of 108.14 g/mol. Its IUPAC name is 2,3-dimethylidene-1,4-dihydropyrazine.
Molecular Properties
| Compound Name | 2,3-dimethylidene-1,4-dihydropyrazine |
| PubChem CID | 71347911 |
| Molecular Formula | C6H8N2 |
| Molecular Weight | 108.14 g/mol |
| Exact Mass | 108.07 |
| IUPAC Name | 2,3-dimethylidene-1,4-dihydropyrazine |
| SMILES | C=C1NC=CNC1=C |
| InChI | InChI=1S/C6H8N2/c1-5-6(2)8-4-3-7-5/h3-4,7-8H,1-2H2 |
| InChIKey | ZAVMNRWZPRXJOH-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.14 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-dimethylidene-1,4-dihydropyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethylidene-1,4-dihydropyrazine?
The IUPAC name of 2,3-dimethylidene-1,4-dihydropyrazine (CID 71347911) is 2,3-dimethylidene-1,4-dihydropyrazine.
What is the SMILES notation for 2,3-dimethylidene-1,4-dihydropyrazine?
The canonical SMILES for 2,3-dimethylidene-1,4-dihydropyrazine is C=C1NC=CNC1=C.
What is the InChIKey of 2,3-dimethylidene-1,4-dihydropyrazine?
The InChIKey is ZAVMNRWZPRXJOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2/c1-5-6(2)8-4-3-7-5/h3-4,7-8H,1-2H2.
What are the key properties of 2,3-dimethylidene-1,4-dihydropyrazine?
2,3-dimethylidene-1,4-dihydropyrazine has a molecular weight of 108.14 g/mol, XLogP of 0.68, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylidene-1,4-dihydropyrazine is sourced from PubChem (CID 71347911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).