About oct-2-en-3-ol
oct-2-en-3-ol (PubChem CID 71348348) has the molecular formula C8H16O
and a molecular weight of 128.21 g/mol. Its IUPAC name is oct-2-en-3-ol.
Molecular Properties
| Compound Name | oct-2-en-3-ol |
| PubChem CID | 71348348 |
| Molecular Formula | C8H16O |
| Molecular Weight | 128.21 g/mol |
| Exact Mass | 128.12 |
| IUPAC Name | oct-2-en-3-ol |
| SMILES | CC=C(O)CCCCC |
| InChI | InChI=1S/C8H16O/c1-3-5-6-7-8(9)4-2/h4,9H,3,5-7H2,1-2H3 |
| InChIKey | UIRVMCAAPSEQTC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.21 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze oct-2-en-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oct-2-en-3-ol?
The IUPAC name of oct-2-en-3-ol (CID 71348348) is oct-2-en-3-ol.
What is the SMILES notation for oct-2-en-3-ol?
The canonical SMILES for oct-2-en-3-ol is CC=C(O)CCCCC.
What is the InChIKey of oct-2-en-3-ol?
The InChIKey is UIRVMCAAPSEQTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O/c1-3-5-6-7-8(9)4-2/h4,9H,3,5-7H2,1-2H3.
What are the key properties of oct-2-en-3-ol?
oct-2-en-3-ol has a molecular weight of 128.21 g/mol, XLogP of 3.03, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for oct-2-en-3-ol is sourced from PubChem (CID 71348348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).