About 1-phenylsulfanylethyl butanoate
1-phenylsulfanylethyl butanoate (PubChem CID 71348497) has the molecular formula C12H16O2S
and a molecular weight of 224.33 g/mol. Its IUPAC name is 1-phenylsulfanylethyl butanoate.
Molecular Properties
| Compound Name | 1-phenylsulfanylethyl butanoate |
| PubChem CID | 71348497 |
| Molecular Formula | C12H16O2S |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 1-phenylsulfanylethyl butanoate |
| SMILES | CCCC(=O)OC(C)Sc1ccccc1 |
| InChI | InChI=1S/C12H16O2S/c1-3-7-12(13)14-10(2)15-11-8-5-4-6-9-11/h4-6,8-10H,3,7H2,1-2H3 |
| InChIKey | IGGNAAWBMGZKLR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylsulfanylethyl butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylsulfanylethyl butanoate?
The IUPAC name of 1-phenylsulfanylethyl butanoate (CID 71348497) is 1-phenylsulfanylethyl butanoate.
What is the SMILES notation for 1-phenylsulfanylethyl butanoate?
The canonical SMILES for 1-phenylsulfanylethyl butanoate is CCCC(=O)OC(C)Sc1ccccc1.
What is the InChIKey of 1-phenylsulfanylethyl butanoate?
The InChIKey is IGGNAAWBMGZKLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O2S/c1-3-7-12(13)14-10(2)15-11-8-5-4-6-9-11/h4-6,8-10H,3,7H2,1-2H3.
What are the key properties of 1-phenylsulfanylethyl butanoate?
1-phenylsulfanylethyl butanoate has a molecular weight of 224.33 g/mol, XLogP of 3.47, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylsulfanylethyl butanoate is sourced from PubChem (CID 71348497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).