About [(2R,3R)-1-amino-3-benzoyloxy-4-(dimethylamino)-1,4-dioxobutan-2-yl] benzoate
[(2R,3R)-1-amino-3-benzoyloxy-4-(dimethylamino)-1,4-dioxobutan-2-yl] benzoate (PubChem CID 71348633) has the molecular formula C20H20N2O6
and a molecular weight of 384.39 g/mol. Its IUPAC name is [(2R,3R)-1-amino-3-benzoyloxy-4-(dimethylamino)-1,4-dioxobutan-2-yl] benzoate.
Molecular Properties
| Compound Name | [(2R,3R)-1-amino-3-benzoyloxy-4-(dimethylamino)-1,4-dioxobutan-2-yl] benzoate |
| PubChem CID | 71348633 |
| Molecular Formula | C20H20N2O6 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | [(2R,3R)-1-amino-3-benzoyloxy-4-(dimethylamino)-1,4-dioxobutan-2-yl] benzoate |
| SMILES | CN(C)C(=O)[C@H](OC(=O)c1ccccc1)[C@@H](OC(=O)c1ccccc1)C(N)=O |
| InChI | InChI=1S/C20H20N2O6/c1-22(2)18(24)16(28-20(26)14-11-7-4-8-12-14)15(17(21)23)27-19(25)13-9-5-3-6-10-13/h3-12,15-16H,1-2H3,(H2,21,23)/t15-,16-/m1/s1 |
| InChIKey | IYQNVCKVMJOAQR-HZPDHXFCSA-N |
| XLogP | 1.01 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [(2R,3R)-1-amino-3-benzoyloxy-4-(dimethylamino)-1,4-dioxobutan-2-yl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3R)-1-amino-3-benzoyloxy-4-(dimethylamino)-1,4-dioxobutan-2-yl] benzoate?
The IUPAC name of [(2R,3R)-1-amino-3-benzoyloxy-4-(dimethylamino)-1,4-dioxobutan-2-yl] benzoate (CID 71348633) is [(2R,3R)-1-amino-3-benzoyloxy-4-(dimethylamino)-1,4-dioxobutan-2-yl] benzoate.
What is the SMILES notation for [(2R,3R)-1-amino-3-benzoyloxy-4-(dimethylamino)-1,4-dioxobutan-2-yl] benzoate?
The canonical SMILES for [(2R,3R)-1-amino-3-benzoyloxy-4-(dimethylamino)-1,4-dioxobutan-2-yl] benzoate is CN(C)C(=O)[C@H](OC(=O)c1ccccc1)[C@@H](OC(=O)c1ccccc1)C(N)=O.
What is the InChIKey of [(2R,3R)-1-amino-3-benzoyloxy-4-(dimethylamino)-1,4-dioxobutan-2-yl] benzoate?
The InChIKey is IYQNVCKVMJOAQR-HZPDHXFCSA-N. The full InChI is InChI=1S/C20H20N2O6/c1-22(2)18(24)16(28-20(26)14-11-7-4-8-12-14)15(17(21)23)27-19(25)13-9-5-3-6-10-13/h3-12,15-16H,1-2H3,(H2,21,23)/t15-,16-/m1/s1.
What are the key properties of [(2R,3R)-1-amino-3-benzoyloxy-4-(dimethylamino)-1,4-dioxobutan-2-yl] benzoate?
[(2R,3R)-1-amino-3-benzoyloxy-4-(dimethylamino)-1,4-dioxobutan-2-yl] benzoate has a molecular weight of 384.39 g/mol, XLogP of 1.01, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3R)-1-amino-3-benzoyloxy-4-(dimethylamino)-1,4-dioxobutan-2-yl] benzoate is sourced from PubChem (CID 71348633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).