About 1-tert-butyl-3,3-dinitroazetidine;nitric acid
1-tert-butyl-3,3-dinitroazetidine;nitric acid (PubChem CID 71348782) has the molecular formula C7H14N4O7
and a molecular weight of 266.21 g/mol. Its IUPAC name is 1-tert-butyl-3,3-dinitroazetidine;nitric acid.
Molecular Properties
| Compound Name | 1-tert-butyl-3,3-dinitroazetidine;nitric acid |
| PubChem CID | 71348782 |
| Molecular Formula | C7H14N4O7 |
| Molecular Weight | 266.21 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 1-tert-butyl-3,3-dinitroazetidine;nitric acid |
| SMILES | CC(C)(C)N1CC([N+](=O)[O-])([N+](=O)[O-])C1.O=[N+]([O-])O |
| InChI | InChI=1S/C7H13N3O4.HNO3/c1-6(2,3)8-4-7(5-8,9(11)12)10(13)14;2-1(3)4/h4-5H2,1-3H3;(H,2,3,4) |
| InChIKey | QXRAWTPBRGLZQJ-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 152.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.21 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-tert-butyl-3,3-dinitroazetidine;nitric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-3,3-dinitroazetidine;nitric acid?
The IUPAC name of 1-tert-butyl-3,3-dinitroazetidine;nitric acid (CID 71348782) is 1-tert-butyl-3,3-dinitroazetidine;nitric acid.
What is the SMILES notation for 1-tert-butyl-3,3-dinitroazetidine;nitric acid?
The canonical SMILES for 1-tert-butyl-3,3-dinitroazetidine;nitric acid is CC(C)(C)N1CC([N+](=O)[O-])([N+](=O)[O-])C1.O=[N+]([O-])O.
What is the InChIKey of 1-tert-butyl-3,3-dinitroazetidine;nitric acid?
The InChIKey is QXRAWTPBRGLZQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3O4.HNO3/c1-6(2,3)8-4-7(5-8,9(11)12)10(13)14;2-1(3)4/h4-5H2,1-3H3;(H,2,3,4).
What are the key properties of 1-tert-butyl-3,3-dinitroazetidine;nitric acid?
1-tert-butyl-3,3-dinitroazetidine;nitric acid has a molecular weight of 266.21 g/mol, XLogP of 0.00, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-3,3-dinitroazetidine;nitric acid is sourced from PubChem (CID 71348782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).