About 3-diazodeca-5,9-dien-2-one
3-diazodeca-5,9-dien-2-one (PubChem CID 71348808) has the molecular formula C10H14N2O
and a molecular weight of 178.23 g/mol. Its IUPAC name is 3-diazodeca-5,9-dien-2-one.
Molecular Properties
| Compound Name | 3-diazodeca-5,9-dien-2-one |
| PubChem CID | 71348808 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 3-diazodeca-5,9-dien-2-one |
| SMILES | C=CCCC=CCC(=[N+]=[N-])C(C)=O |
| InChI | InChI=1S/C10H14N2O/c1-3-4-5-6-7-8-10(12-11)9(2)13/h3,6-7H,1,4-5,8H2,2H3 |
| InChIKey | LPLVEIMUKJWVIP-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-diazodeca-5,9-dien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-diazodeca-5,9-dien-2-one?
The IUPAC name of 3-diazodeca-5,9-dien-2-one (CID 71348808) is 3-diazodeca-5,9-dien-2-one.
What is the SMILES notation for 3-diazodeca-5,9-dien-2-one?
The canonical SMILES for 3-diazodeca-5,9-dien-2-one is C=CCCC=CCC(=[N+]=[N-])C(C)=O.
What is the InChIKey of 3-diazodeca-5,9-dien-2-one?
The InChIKey is LPLVEIMUKJWVIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O/c1-3-4-5-6-7-8-10(12-11)9(2)13/h3,6-7H,1,4-5,8H2,2H3.
What are the key properties of 3-diazodeca-5,9-dien-2-one?
3-diazodeca-5,9-dien-2-one has a molecular weight of 178.23 g/mol, XLogP of 2.16, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-diazodeca-5,9-dien-2-one is sourced from PubChem (CID 71348808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).