About 3-hex-2-enoyl-1,3-oxazolidin-2-one
3-hex-2-enoyl-1,3-oxazolidin-2-one (PubChem CID 71350120) has the molecular formula C9H13NO3
and a molecular weight of 183.21 g/mol. Its IUPAC name is 3-hex-2-enoyl-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 3-hex-2-enoyl-1,3-oxazolidin-2-one |
| PubChem CID | 71350120 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | 3-hex-2-enoyl-1,3-oxazolidin-2-one |
| SMILES | CCCC=CC(=O)N1CCOC1=O |
| InChI | InChI=1S/C9H13NO3/c1-2-3-4-5-8(11)10-6-7-13-9(10)12/h4-5H,2-3,6-7H2,1H3 |
| InChIKey | JTJNYQJBLNODEB-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-hex-2-enoyl-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hex-2-enoyl-1,3-oxazolidin-2-one?
The IUPAC name of 3-hex-2-enoyl-1,3-oxazolidin-2-one (CID 71350120) is 3-hex-2-enoyl-1,3-oxazolidin-2-one.
What is the SMILES notation for 3-hex-2-enoyl-1,3-oxazolidin-2-one?
The canonical SMILES for 3-hex-2-enoyl-1,3-oxazolidin-2-one is CCCC=CC(=O)N1CCOC1=O.
What is the InChIKey of 3-hex-2-enoyl-1,3-oxazolidin-2-one?
The InChIKey is JTJNYQJBLNODEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO3/c1-2-3-4-5-8(11)10-6-7-13-9(10)12/h4-5H,2-3,6-7H2,1H3.
What are the key properties of 3-hex-2-enoyl-1,3-oxazolidin-2-one?
3-hex-2-enoyl-1,3-oxazolidin-2-one has a molecular weight of 183.21 g/mol, XLogP of 1.32, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hex-2-enoyl-1,3-oxazolidin-2-one is sourced from PubChem (CID 71350120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).