C10H9F15O3Si — CID 71350227
methyl-tris(2,2,3,3,3-pentafluoropropoxy)silane (PubChem CID 71350227) has the molecular formula C10H9F15O3Si and a molecular weight of 490.24 g/mol. Its IUPAC name is methyl-tris(2,2,3,3,3-pentafluoropropoxy)silane.
| Compound Name | methyl-tris(2,2,3,3,3-pentafluoropropoxy)silane |
|---|---|
| PubChem CID | 71350227 |
| Molecular Formula | C10H9F15O3Si |
| Molecular Weight | 490.24 g/mol |
| Exact Mass | 490.01 |
| IUPAC Name | methyl-tris(2,2,3,3,3-pentafluoropropoxy)silane |
| SMILES | C[Si](OCC(F)(F)C(F)(F)F)(OCC(F)(F)C(F)(F)F)OCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H9F15O3Si/c1-29(26-2-5(11,12)8(17,18)19,27-3-6(13,14)9(20,21)22)28-4-7(15,16)10(23,24)25/h2-4H2,1H3 |
| InChIKey | VBTXHVSHBNHQHL-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.24 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|