C23H44O2 — CID 71350555
2,2-dimethyl-4-(6,10,14-trimethylpentadec-1-en-2-yl)-1,3-dioxolane (PubChem CID 71350555) has the molecular formula C23H44O2 and a molecular weight of 352.60 g/mol. Its IUPAC name is 2,2-dimethyl-4-(6,10,14-trimethylpentadec-1-en-2-yl)-1,3-dioxolane.
| Compound Name | 2,2-dimethyl-4-(6,10,14-trimethylpentadec-1-en-2-yl)-1,3-dioxolane |
|---|---|
| PubChem CID | 71350555 |
| Molecular Formula | C23H44O2 |
| Molecular Weight | 352.60 g/mol |
| Exact Mass | 352.33 |
| IUPAC Name | 2,2-dimethyl-4-(6,10,14-trimethylpentadec-1-en-2-yl)-1,3-dioxolane |
| SMILES | C=C(CCCC(C)CCCC(C)CCCC(C)C)C1COC(C)(C)O1 |
| InChI | InChI=1S/C23H44O2/c1-18(2)11-8-12-19(3)13-9-14-20(4)15-10-16-21(5)22-17-24-23(6,7)25-22/h18-20,22H,5,8-17H2,1-4,6-7H3 |
| InChIKey | VFERIWCUTWMDSS-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.60 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|