About (1-cyclopent-3-en-1-yl-3,3-dimethylbutyl)-dimethylsilane
(1-cyclopent-3-en-1-yl-3,3-dimethylbutyl)-dimethylsilane (PubChem CID 71350570) has the molecular formula C13H26Si
and a molecular weight of 210.44 g/mol. Its IUPAC name is (1-cyclopent-3-en-1-yl-3,3-dimethylbutyl)-dimethylsilane.
Molecular Properties
| Compound Name | (1-cyclopent-3-en-1-yl-3,3-dimethylbutyl)-dimethylsilane |
| PubChem CID | 71350570 |
| Molecular Formula | C13H26Si |
| Molecular Weight | 210.44 g/mol |
| Exact Mass | 210.18 |
| IUPAC Name | (1-cyclopent-3-en-1-yl-3,3-dimethylbutyl)-dimethylsilane |
| SMILES | C[SiH](C)C(CC(C)(C)C)C1CC=CC1 |
| InChI | InChI=1S/C13H26Si/c1-13(2,3)10-12(14(4)5)11-8-6-7-9-11/h6-7,11-12,14H,8-10H2,1-5H3 |
| InChIKey | PMZCMPCAZYHKLI-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.44 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1-cyclopent-3-en-1-yl-3,3-dimethylbutyl)-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-cyclopent-3-en-1-yl-3,3-dimethylbutyl)-dimethylsilane?
The IUPAC name of (1-cyclopent-3-en-1-yl-3,3-dimethylbutyl)-dimethylsilane (CID 71350570) is (1-cyclopent-3-en-1-yl-3,3-dimethylbutyl)-dimethylsilane.
What is the SMILES notation for (1-cyclopent-3-en-1-yl-3,3-dimethylbutyl)-dimethylsilane?
The canonical SMILES for (1-cyclopent-3-en-1-yl-3,3-dimethylbutyl)-dimethylsilane is C[SiH](C)C(CC(C)(C)C)C1CC=CC1.
What is the InChIKey of (1-cyclopent-3-en-1-yl-3,3-dimethylbutyl)-dimethylsilane?
The InChIKey is PMZCMPCAZYHKLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26Si/c1-13(2,3)10-12(14(4)5)11-8-6-7-9-11/h6-7,11-12,14H,8-10H2,1-5H3.
What are the key properties of (1-cyclopent-3-en-1-yl-3,3-dimethylbutyl)-dimethylsilane?
(1-cyclopent-3-en-1-yl-3,3-dimethylbutyl)-dimethylsilane has a molecular weight of 210.44 g/mol, XLogP of 4.25, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1-cyclopent-3-en-1-yl-3,3-dimethylbutyl)-dimethylsilane is sourced from PubChem (CID 71350570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).