About 2-methyl-2-(trifluoromethyl)-1,3-dihydrobenzimidazole
2-methyl-2-(trifluoromethyl)-1,3-dihydrobenzimidazole (PubChem CID 71350606) has the molecular formula C9H9F3N2
and a molecular weight of 202.18 g/mol. Its IUPAC name is 2-methyl-2-(trifluoromethyl)-1,3-dihydrobenzimidazole.
Molecular Properties
| Compound Name | 2-methyl-2-(trifluoromethyl)-1,3-dihydrobenzimidazole |
| PubChem CID | 71350606 |
| Molecular Formula | C9H9F3N2 |
| Molecular Weight | 202.18 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 2-methyl-2-(trifluoromethyl)-1,3-dihydrobenzimidazole |
| SMILES | CC1(C(F)(F)F)Nc2ccccc2N1 |
| InChI | InChI=1S/C9H9F3N2/c1-8(9(10,11)12)13-6-4-2-3-5-7(6)14-8/h2-5,13-14H,1H3 |
| InChIKey | VEEGTLJYYNMJPG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.18 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-2-(trifluoromethyl)-1,3-dihydrobenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-(trifluoromethyl)-1,3-dihydrobenzimidazole?
The IUPAC name of 2-methyl-2-(trifluoromethyl)-1,3-dihydrobenzimidazole (CID 71350606) is 2-methyl-2-(trifluoromethyl)-1,3-dihydrobenzimidazole.
What is the SMILES notation for 2-methyl-2-(trifluoromethyl)-1,3-dihydrobenzimidazole?
The canonical SMILES for 2-methyl-2-(trifluoromethyl)-1,3-dihydrobenzimidazole is CC1(C(F)(F)F)Nc2ccccc2N1.
What is the InChIKey of 2-methyl-2-(trifluoromethyl)-1,3-dihydrobenzimidazole?
The InChIKey is VEEGTLJYYNMJPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F3N2/c1-8(9(10,11)12)13-6-4-2-3-5-7(6)14-8/h2-5,13-14H,1H3.
What are the key properties of 2-methyl-2-(trifluoromethyl)-1,3-dihydrobenzimidazole?
2-methyl-2-(trifluoromethyl)-1,3-dihydrobenzimidazole has a molecular weight of 202.18 g/mol, XLogP of 2.80, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-(trifluoromethyl)-1,3-dihydrobenzimidazole is sourced from PubChem (CID 71350606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).