About ethyl octadec-8-enoate
ethyl octadec-8-enoate (PubChem CID 71350628) has the molecular formula C20H38O2
and a molecular weight of 310.52 g/mol. Its IUPAC name is ethyl octadec-8-enoate.
Molecular Properties
| Compound Name | ethyl octadec-8-enoate |
| PubChem CID | 71350628 |
| Molecular Formula | C20H38O2 |
| Molecular Weight | 310.52 g/mol |
| Exact Mass | 310.29 |
| IUPAC Name | ethyl octadec-8-enoate |
| SMILES | CCCCCCCCCC=CCCCCCCC(=O)OCC |
| InChI | InChI=1S/C20H38O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22-4-2/h12-13H,3-11,14-19H2,1-2H3 |
| InChIKey | VSWIUGYJLIZPHM-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.52 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl octadec-8-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl octadec-8-enoate?
The IUPAC name of ethyl octadec-8-enoate (CID 71350628) is ethyl octadec-8-enoate.
What is the SMILES notation for ethyl octadec-8-enoate?
The canonical SMILES for ethyl octadec-8-enoate is CCCCCCCCCC=CCCCCCCC(=O)OCC.
What is the InChIKey of ethyl octadec-8-enoate?
The InChIKey is VSWIUGYJLIZPHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H38O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22-4-2/h12-13H,3-11,14-19H2,1-2H3.
What are the key properties of ethyl octadec-8-enoate?
ethyl octadec-8-enoate has a molecular weight of 310.52 g/mol, XLogP of 6.59, 16 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl octadec-8-enoate is sourced from PubChem (CID 71350628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).