About (4aR,4bR)-4a,4b-dihydrophenanthrene
(4aR,4bR)-4a,4b-dihydrophenanthrene (PubChem CID 71350891) has the molecular formula C14H12
and a molecular weight of 180.25 g/mol. Its IUPAC name is (4aR,4bR)-4a,4b-dihydrophenanthrene.
Molecular Properties
| Compound Name | (4aR,4bR)-4a,4b-dihydrophenanthrene |
| PubChem CID | 71350891 |
| Molecular Formula | C14H12 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | (4aR,4bR)-4a,4b-dihydrophenanthrene |
| SMILES | C1=CC2=CC=C3C=CC=C[C@@H]3[C@H]2C=C1 |
| InChI | InChI=1S/C14H12/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13/h1-10,13-14H/t13-,14-/m0/s1 |
| InChIKey | ZQNQJMXFVWUBDO-KBPBESRZSA-N |
| XLogP | 3.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (4aR,4bR)-4a,4b-dihydrophenanthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4aR,4bR)-4a,4b-dihydrophenanthrene?
The IUPAC name of (4aR,4bR)-4a,4b-dihydrophenanthrene (CID 71350891) is (4aR,4bR)-4a,4b-dihydrophenanthrene.
What is the SMILES notation for (4aR,4bR)-4a,4b-dihydrophenanthrene?
The canonical SMILES for (4aR,4bR)-4a,4b-dihydrophenanthrene is C1=CC2=CC=C3C=CC=C[C@@H]3[C@H]2C=C1.
What is the InChIKey of (4aR,4bR)-4a,4b-dihydrophenanthrene?
The InChIKey is ZQNQJMXFVWUBDO-KBPBESRZSA-N. The full InChI is InChI=1S/C14H12/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13/h1-10,13-14H/t13-,14-/m0/s1.
What are the key properties of (4aR,4bR)-4a,4b-dihydrophenanthrene?
(4aR,4bR)-4a,4b-dihydrophenanthrene has a molecular weight of 180.25 g/mol, XLogP of 3.34, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (4aR,4bR)-4a,4b-dihydrophenanthrene is sourced from PubChem (CID 71350891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).