C15H30OSi — CID 71351072
(8-methoxy-2,5,5-trimethylocta-2,7-dienyl)-trimethylsilane (PubChem CID 71351072) has the molecular formula C15H30OSi and a molecular weight of 254.49 g/mol. Its IUPAC name is (8-methoxy-2,5,5-trimethylocta-2,7-dienyl)-trimethylsilane.
| Compound Name | (8-methoxy-2,5,5-trimethylocta-2,7-dienyl)-trimethylsilane |
|---|---|
| PubChem CID | 71351072 |
| Molecular Formula | C15H30OSi |
| Molecular Weight | 254.49 g/mol |
| Exact Mass | 254.21 |
| IUPAC Name | (8-methoxy-2,5,5-trimethylocta-2,7-dienyl)-trimethylsilane |
| SMILES | COC=CCC(C)(C)CC=C(C)C[Si](C)(C)C |
| InChI | InChI=1S/C15H30OSi/c1-14(13-17(5,6)7)9-11-15(2,3)10-8-12-16-4/h8-9,12H,10-11,13H2,1-7H3 |
| InChIKey | SBTVRIUQNHYZRA-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.49 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|