C9H12O3 — CID 71351270
(3aS,7aR)-7a-methyl-4,5,6,7-tetrahydro-3aH-2-benzofuran-1,3-dione (PubChem CID 71351270) has the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. Its IUPAC name is (3aS,7aR)-7a-methyl-4,5,6,7-tetrahydro-3aH-2-benzofuran-1,3-dione.
| Compound Name | (3aS,7aR)-7a-methyl-4,5,6,7-tetrahydro-3aH-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 71351270 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | (3aS,7aR)-7a-methyl-4,5,6,7-tetrahydro-3aH-2-benzofuran-1,3-dione |
| SMILES | C[C@@]12CCCC[C@@H]1C(=O)OC2=O |
| InChI | InChI=1S/C9H12O3/c1-9-5-3-2-4-6(9)7(10)12-8(9)11/h6H,2-5H2,1H3/t6-,9-/m1/s1 |
| InChIKey | VYKXQOYUCMREIS-HZGVNTEJSA-N |
| XLogP | 1.27 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|