C17H17N3O2 — CID 71351446
(2S,7S)-1-nitroso-2,7-diphenyl-1,4-diazepan-5-one (PubChem CID 71351446) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is (2S,7S)-1-nitroso-2,7-diphenyl-1,4-diazepan-5-one.
| Compound Name | (2S,7S)-1-nitroso-2,7-diphenyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 71351446 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | (2S,7S)-1-nitroso-2,7-diphenyl-1,4-diazepan-5-one |
| SMILES | O=NN1[C@@H](c2ccccc2)CNC(=O)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C17H17N3O2/c21-17-11-15(13-7-3-1-4-8-13)20(19-22)16(12-18-17)14-9-5-2-6-10-14/h1-10,15-16H,11-12H2,(H,18,21)/t15-,16+/m0/s1 |
| InChIKey | KKRMFFAUUDPTSQ-JKSUJKDBSA-N |
| XLogP | 2.97 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|