trimethyl(trimethylsilylmethyl)phosphanium chloride

C7H20ClPSi — CID 71352682

IUPACtrimethyl(trimethylsilylmethyl)phosphanium chloride
SMILESC[Si](C)(C)C[P+](C)(C)C.[Cl-]
InChIInChI=1S/C7H20PSi.ClH/c1-8(2,3)7-9(4,5)6;/h7H2,1-6H3;1H/q+1;/p-1
InChIKeyFXOBJRBQXFBGSH-UHFFFAOYSA-M
MW198.75 g/mol
LogP-0.23
Rot. Bonds2

About trimethyl(trimethylsilylmethyl)phosphanium chloride

trimethyl(trimethylsilylmethyl)phosphanium chloride (PubChem CID 71352682) has the molecular formula C7H20ClPSi and a molecular weight of 198.75 g/mol. Its IUPAC name is trimethyl(trimethylsilylmethyl)phosphanium chloride.

Molecular Properties

Compound Nametrimethyl(trimethylsilylmethyl)phosphanium chloride
PubChem CID71352682
Molecular FormulaC7H20ClPSi
Molecular Weight198.75 g/mol
Exact Mass198.08
IUPAC Nametrimethyl(trimethylsilylmethyl)phosphanium chloride
SMILESC[Si](C)(C)C[P+](C)(C)C.[Cl-]
InChIInChI=1S/C7H20PSi.ClH/c1-8(2,3)7-9(4,5)6;/h7H2,1-6H3;1H/q+1;/p-1
InChIKeyFXOBJRBQXFBGSH-UHFFFAOYSA-M
XLogP-0.23
TPSA0.00 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds2
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500198.75
LogP ≤ 5-0.23
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze trimethyl(trimethylsilylmethyl)phosphanium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of trimethyl(trimethylsilylmethyl)phosphanium chloride?
The IUPAC name of trimethyl(trimethylsilylmethyl)phosphanium chloride (CID 71352682) is trimethyl(trimethylsilylmethyl)phosphanium chloride.
What is the SMILES notation for trimethyl(trimethylsilylmethyl)phosphanium chloride?
The canonical SMILES for trimethyl(trimethylsilylmethyl)phosphanium chloride is C[Si](C)(C)C[P+](C)(C)C.[Cl-].
What is the InChIKey of trimethyl(trimethylsilylmethyl)phosphanium chloride?
The InChIKey is FXOBJRBQXFBGSH-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H20PSi.ClH/c1-8(2,3)7-9(4,5)6;/h7H2,1-6H3;1H/q+1;/p-1.
What are the key properties of trimethyl(trimethylsilylmethyl)phosphanium chloride?
trimethyl(trimethylsilylmethyl)phosphanium chloride has a molecular weight of 198.75 g/mol, XLogP of -0.23, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl(trimethylsilylmethyl)phosphanium chloride is sourced from PubChem (CID 71352682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).