About (2R)-2-aminohept-6-enoic acid
(2R)-2-aminohept-6-enoic acid (PubChem CID 71352792) has the molecular formula C7H13NO2
and a molecular weight of 143.19 g/mol. Its IUPAC name is (2R)-2-aminohept-6-enoic acid.
Molecular Properties
| Compound Name | (2R)-2-aminohept-6-enoic acid |
| PubChem CID | 71352792 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | (2R)-2-aminohept-6-enoic acid |
| SMILES | C=CCCC[C@@H](N)C(=O)O |
| InChI | InChI=1S/C7H13NO2/c1-2-3-4-5-6(8)7(9)10/h2,6H,1,3-5,8H2,(H,9,10)/t6-/m1/s1 |
| InChIKey | OOOVDVSHGOKTNT-ZCFIWIBFSA-N |
| XLogP | 0.75 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-aminohept-6-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-aminohept-6-enoic acid?
The IUPAC name of (2R)-2-aminohept-6-enoic acid (CID 71352792) is (2R)-2-aminohept-6-enoic acid.
What is the SMILES notation for (2R)-2-aminohept-6-enoic acid?
The canonical SMILES for (2R)-2-aminohept-6-enoic acid is C=CCCC[C@@H](N)C(=O)O.
What is the InChIKey of (2R)-2-aminohept-6-enoic acid?
The InChIKey is OOOVDVSHGOKTNT-ZCFIWIBFSA-N. The full InChI is InChI=1S/C7H13NO2/c1-2-3-4-5-6(8)7(9)10/h2,6H,1,3-5,8H2,(H,9,10)/t6-/m1/s1.
What are the key properties of (2R)-2-aminohept-6-enoic acid?
(2R)-2-aminohept-6-enoic acid has a molecular weight of 143.19 g/mol, XLogP of 0.75, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-aminohept-6-enoic acid is sourced from PubChem (CID 71352792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).