(2R)-2-aminohept-6-enoic acid

C7H13NO2 — CID 71352792

IUPAC(2R)-2-aminohept-6-enoic acid
SMILESC=CCCC[C@@H](N)C(=O)O
InChIInChI=1S/C7H13NO2/c1-2-3-4-5-6(8)7(9)10/h2,6H,1,3-5,8H2,(H,9,10)/t6-/m1/s1
InChIKeyOOOVDVSHGOKTNT-ZCFIWIBFSA-N
MW143.19 g/mol
LogP0.75
Rot. Bonds5

About (2R)-2-aminohept-6-enoic acid

(2R)-2-aminohept-6-enoic acid (PubChem CID 71352792) has the molecular formula C7H13NO2 and a molecular weight of 143.19 g/mol. Its IUPAC name is (2R)-2-aminohept-6-enoic acid.

Molecular Properties

Compound Name(2R)-2-aminohept-6-enoic acid
PubChem CID71352792
Molecular FormulaC7H13NO2
Molecular Weight143.19 g/mol
Exact Mass143.09
IUPAC Name(2R)-2-aminohept-6-enoic acid
SMILESC=CCCC[C@@H](N)C(=O)O
InChIInChI=1S/C7H13NO2/c1-2-3-4-5-6(8)7(9)10/h2,6H,1,3-5,8H2,(H,9,10)/t6-/m1/s1
InChIKeyOOOVDVSHGOKTNT-ZCFIWIBFSA-N
XLogP0.75
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500143.19
LogP ≤ 50.75
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (2R)-2-aminohept-6-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2-aminohept-6-enoic acid?
The IUPAC name of (2R)-2-aminohept-6-enoic acid (CID 71352792) is (2R)-2-aminohept-6-enoic acid.
What is the SMILES notation for (2R)-2-aminohept-6-enoic acid?
The canonical SMILES for (2R)-2-aminohept-6-enoic acid is C=CCCC[C@@H](N)C(=O)O.
What is the InChIKey of (2R)-2-aminohept-6-enoic acid?
The InChIKey is OOOVDVSHGOKTNT-ZCFIWIBFSA-N. The full InChI is InChI=1S/C7H13NO2/c1-2-3-4-5-6(8)7(9)10/h2,6H,1,3-5,8H2,(H,9,10)/t6-/m1/s1.
What are the key properties of (2R)-2-aminohept-6-enoic acid?
(2R)-2-aminohept-6-enoic acid has a molecular weight of 143.19 g/mol, XLogP of 0.75, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-aminohept-6-enoic acid is sourced from PubChem (CID 71352792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).