About (3S)-2,6-dimethylhept-6-ene-2,3-diol
(3S)-2,6-dimethylhept-6-ene-2,3-diol (PubChem CID 71352856) has the molecular formula C9H18O2
and a molecular weight of 158.24 g/mol. Its IUPAC name is (3S)-2,6-dimethylhept-6-ene-2,3-diol.
Molecular Properties
| Compound Name | (3S)-2,6-dimethylhept-6-ene-2,3-diol |
| PubChem CID | 71352856 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | (3S)-2,6-dimethylhept-6-ene-2,3-diol |
| SMILES | C=C(C)CC[C@H](O)C(C)(C)O |
| InChI | InChI=1S/C9H18O2/c1-7(2)5-6-8(10)9(3,4)11/h8,10-11H,1,5-6H2,2-4H3/t8-/m0/s1 |
| InChIKey | OSTJSCLDWFZDSA-QMMMGPOBSA-N |
| XLogP | 1.47 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3S)-2,6-dimethylhept-6-ene-2,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-2,6-dimethylhept-6-ene-2,3-diol?
The IUPAC name of (3S)-2,6-dimethylhept-6-ene-2,3-diol (CID 71352856) is (3S)-2,6-dimethylhept-6-ene-2,3-diol.
What is the SMILES notation for (3S)-2,6-dimethylhept-6-ene-2,3-diol?
The canonical SMILES for (3S)-2,6-dimethylhept-6-ene-2,3-diol is C=C(C)CC[C@H](O)C(C)(C)O.
What is the InChIKey of (3S)-2,6-dimethylhept-6-ene-2,3-diol?
The InChIKey is OSTJSCLDWFZDSA-QMMMGPOBSA-N. The full InChI is InChI=1S/C9H18O2/c1-7(2)5-6-8(10)9(3,4)11/h8,10-11H,1,5-6H2,2-4H3/t8-/m0/s1.
What are the key properties of (3S)-2,6-dimethylhept-6-ene-2,3-diol?
(3S)-2,6-dimethylhept-6-ene-2,3-diol has a molecular weight of 158.24 g/mol, XLogP of 1.47, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-2,6-dimethylhept-6-ene-2,3-diol is sourced from PubChem (CID 71352856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).