About (1S,5S)-bicyclo[3.3.1]nonane-2,6-dione
(1S,5S)-bicyclo[3.3.1]nonane-2,6-dione (PubChem CID 713530) has the molecular formula C9H12O2
and a molecular weight of 152.19 g/mol. Its IUPAC name is (1S,5S)-bicyclo[3.3.1]nonane-2,6-dione.
Molecular Properties
| Compound Name | (1S,5S)-bicyclo[3.3.1]nonane-2,6-dione |
| PubChem CID | 713530 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | (1S,5S)-bicyclo[3.3.1]nonane-2,6-dione |
| SMILES | O=C1CC[C@H]2C[C@@H]1CCC2=O |
| InChI | InChI=1S/C9H12O2/c10-8-3-1-6-5-7(8)2-4-9(6)11/h6-7H,1-5H2/t6-,7-/m0/s1 |
| InChIKey | QWNPVTXLBMSEPN-BQBZGAKWSA-N |
| XLogP | 1.33 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S,5S)-bicyclo[3.3.1]nonane-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,5S)-bicyclo[3.3.1]nonane-2,6-dione?
The IUPAC name of (1S,5S)-bicyclo[3.3.1]nonane-2,6-dione (CID 713530) is (1S,5S)-bicyclo[3.3.1]nonane-2,6-dione.
What is the SMILES notation for (1S,5S)-bicyclo[3.3.1]nonane-2,6-dione?
The canonical SMILES for (1S,5S)-bicyclo[3.3.1]nonane-2,6-dione is O=C1CC[C@H]2C[C@@H]1CCC2=O.
What is the InChIKey of (1S,5S)-bicyclo[3.3.1]nonane-2,6-dione?
The InChIKey is QWNPVTXLBMSEPN-BQBZGAKWSA-N. The full InChI is InChI=1S/C9H12O2/c10-8-3-1-6-5-7(8)2-4-9(6)11/h6-7H,1-5H2/t6-,7-/m0/s1.
What are the key properties of (1S,5S)-bicyclo[3.3.1]nonane-2,6-dione?
(1S,5S)-bicyclo[3.3.1]nonane-2,6-dione has a molecular weight of 152.19 g/mol, XLogP of 1.33, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,5S)-bicyclo[3.3.1]nonane-2,6-dione is sourced from PubChem (CID 713530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).