C11H7Cl4NO2S — CID 71353288
1-methyl-4-(1,3,4,4-tetrachloro-2-nitrobuta-1,3-dienyl)sulfanylbenzene (PubChem CID 71353288) has the molecular formula C11H7Cl4NO2S and a molecular weight of 359.06 g/mol. Its IUPAC name is 1-methyl-4-(1,3,4,4-tetrachloro-2-nitrobuta-1,3-dienyl)sulfanylbenzene.
| Compound Name | 1-methyl-4-(1,3,4,4-tetrachloro-2-nitrobuta-1,3-dienyl)sulfanylbenzene |
|---|---|
| PubChem CID | 71353288 |
| Molecular Formula | C11H7Cl4NO2S |
| Molecular Weight | 359.06 g/mol |
| Exact Mass | 356.90 |
| IUPAC Name | 1-methyl-4-(1,3,4,4-tetrachloro-2-nitrobuta-1,3-dienyl)sulfanylbenzene |
| SMILES | Cc1ccc(SC(Cl)=C(C(Cl)=C(Cl)Cl)[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H7Cl4NO2S/c1-6-2-4-7(5-3-6)19-11(15)9(16(17)18)8(12)10(13)14/h2-5H,1H3 |
| InChIKey | SXDOQPILVMKHBZ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.06 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|