About 4-(difluoromethylidene)cyclohexa-2,5-dien-1-one
4-(difluoromethylidene)cyclohexa-2,5-dien-1-one (PubChem CID 71353476) has the molecular formula C7H4F2O
and a molecular weight of 142.10 g/mol. Its IUPAC name is 4-(difluoromethylidene)cyclohexa-2,5-dien-1-one.
Molecular Properties
| Compound Name | 4-(difluoromethylidene)cyclohexa-2,5-dien-1-one |
| PubChem CID | 71353476 |
| Molecular Formula | C7H4F2O |
| Molecular Weight | 142.10 g/mol |
| Exact Mass | 142.02 |
| IUPAC Name | 4-(difluoromethylidene)cyclohexa-2,5-dien-1-one |
| SMILES | O=C1C=CC(=C(F)F)C=C1 |
| InChI | InChI=1S/C7H4F2O/c8-7(9)5-1-3-6(10)4-2-5/h1-4H |
| InChIKey | NCNVHAYDTKINCS-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.10 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(difluoromethylidene)cyclohexa-2,5-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(difluoromethylidene)cyclohexa-2,5-dien-1-one?
The IUPAC name of 4-(difluoromethylidene)cyclohexa-2,5-dien-1-one (CID 71353476) is 4-(difluoromethylidene)cyclohexa-2,5-dien-1-one.
What is the SMILES notation for 4-(difluoromethylidene)cyclohexa-2,5-dien-1-one?
The canonical SMILES for 4-(difluoromethylidene)cyclohexa-2,5-dien-1-one is O=C1C=CC(=C(F)F)C=C1.
What is the InChIKey of 4-(difluoromethylidene)cyclohexa-2,5-dien-1-one?
The InChIKey is NCNVHAYDTKINCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4F2O/c8-7(9)5-1-3-6(10)4-2-5/h1-4H.
What are the key properties of 4-(difluoromethylidene)cyclohexa-2,5-dien-1-one?
4-(difluoromethylidene)cyclohexa-2,5-dien-1-one has a molecular weight of 142.10 g/mol, XLogP of 1.83, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(difluoromethylidene)cyclohexa-2,5-dien-1-one is sourced from PubChem (CID 71353476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).