About 2-buta-1,3-dienyl-4-penta-1,3-dienyloxolan-3-ol
2-buta-1,3-dienyl-4-penta-1,3-dienyloxolan-3-ol (PubChem CID 71353983) has the molecular formula C13H18O2
and a molecular weight of 206.28 g/mol. Its IUPAC name is 2-buta-1,3-dienyl-4-penta-1,3-dienyloxolan-3-ol.
Molecular Properties
| Compound Name | 2-buta-1,3-dienyl-4-penta-1,3-dienyloxolan-3-ol |
| PubChem CID | 71353983 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 2-buta-1,3-dienyl-4-penta-1,3-dienyloxolan-3-ol |
| SMILES | C=CC=CC1OCC(C=CC=CC)C1O |
| InChI | InChI=1S/C13H18O2/c1-3-5-7-8-11-10-15-12(13(11)14)9-6-4-2/h3-9,11-14H,2,10H2,1H3 |
| InChIKey | DTLKTHCXEMHTIQ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-buta-1,3-dienyl-4-penta-1,3-dienyloxolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-buta-1,3-dienyl-4-penta-1,3-dienyloxolan-3-ol?
The IUPAC name of 2-buta-1,3-dienyl-4-penta-1,3-dienyloxolan-3-ol (CID 71353983) is 2-buta-1,3-dienyl-4-penta-1,3-dienyloxolan-3-ol.
What is the SMILES notation for 2-buta-1,3-dienyl-4-penta-1,3-dienyloxolan-3-ol?
The canonical SMILES for 2-buta-1,3-dienyl-4-penta-1,3-dienyloxolan-3-ol is C=CC=CC1OCC(C=CC=CC)C1O.
What is the InChIKey of 2-buta-1,3-dienyl-4-penta-1,3-dienyloxolan-3-ol?
The InChIKey is DTLKTHCXEMHTIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O2/c1-3-5-7-8-11-10-15-12(13(11)14)9-6-4-2/h3-9,11-14H,2,10H2,1H3.
What are the key properties of 2-buta-1,3-dienyl-4-penta-1,3-dienyloxolan-3-ol?
2-buta-1,3-dienyl-4-penta-1,3-dienyloxolan-3-ol has a molecular weight of 206.28 g/mol, XLogP of 2.24, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-buta-1,3-dienyl-4-penta-1,3-dienyloxolan-3-ol is sourced from PubChem (CID 71353983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).