About (2S,3S)-2,3-difluorooxane
(2S,3S)-2,3-difluorooxane (PubChem CID 71354306) has the molecular formula C5H8F2O
and a molecular weight of 122.11 g/mol. Its IUPAC name is (2S,3S)-2,3-difluorooxane.
Molecular Properties
| Compound Name | (2S,3S)-2,3-difluorooxane |
| PubChem CID | 71354306 |
| Molecular Formula | C5H8F2O |
| Molecular Weight | 122.11 g/mol |
| Exact Mass | 122.05 |
| IUPAC Name | (2S,3S)-2,3-difluorooxane |
| SMILES | F[C@@H]1OCCC[C@@H]1F |
| InChI | InChI=1S/C5H8F2O/c6-4-2-1-3-8-5(4)7/h4-5H,1-3H2/t4-,5+/m0/s1 |
| InChIKey | YGIYUAMAIOGVRI-CRCLSJGQSA-N |
| XLogP | 1.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.11 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S,3S)-2,3-difluorooxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-2,3-difluorooxane?
The IUPAC name of (2S,3S)-2,3-difluorooxane (CID 71354306) is (2S,3S)-2,3-difluorooxane.
What is the SMILES notation for (2S,3S)-2,3-difluorooxane?
The canonical SMILES for (2S,3S)-2,3-difluorooxane is F[C@@H]1OCCC[C@@H]1F.
What is the InChIKey of (2S,3S)-2,3-difluorooxane?
The InChIKey is YGIYUAMAIOGVRI-CRCLSJGQSA-N. The full InChI is InChI=1S/C5H8F2O/c6-4-2-1-3-8-5(4)7/h4-5H,1-3H2/t4-,5+/m0/s1.
What are the key properties of (2S,3S)-2,3-difluorooxane?
(2S,3S)-2,3-difluorooxane has a molecular weight of 122.11 g/mol, XLogP of 1.43, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-2,3-difluorooxane is sourced from PubChem (CID 71354306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).