About (5S)-5-(1,3-thiazol-2-yl)oxolan-2-one
(5S)-5-(1,3-thiazol-2-yl)oxolan-2-one (PubChem CID 71354365) has the molecular formula C7H7NO2S
and a molecular weight of 169.21 g/mol. Its IUPAC name is (5S)-5-(1,3-thiazol-2-yl)oxolan-2-one.
Molecular Properties
| Compound Name | (5S)-5-(1,3-thiazol-2-yl)oxolan-2-one |
| PubChem CID | 71354365 |
| Molecular Formula | C7H7NO2S |
| Molecular Weight | 169.21 g/mol |
| Exact Mass | 169.02 |
| IUPAC Name | (5S)-5-(1,3-thiazol-2-yl)oxolan-2-one |
| SMILES | O=C1CC[C@@H](c2nccs2)O1 |
| InChI | InChI=1S/C7H7NO2S/c9-6-2-1-5(10-6)7-8-3-4-11-7/h3-5H,1-2H2/t5-/m0/s1 |
| InChIKey | HLKDVGANNOBXFQ-YFKPBYRVSA-N |
| XLogP | 1.52 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.21 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5S)-5-(1,3-thiazol-2-yl)oxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-(1,3-thiazol-2-yl)oxolan-2-one?
The IUPAC name of (5S)-5-(1,3-thiazol-2-yl)oxolan-2-one (CID 71354365) is (5S)-5-(1,3-thiazol-2-yl)oxolan-2-one.
What is the SMILES notation for (5S)-5-(1,3-thiazol-2-yl)oxolan-2-one?
The canonical SMILES for (5S)-5-(1,3-thiazol-2-yl)oxolan-2-one is O=C1CC[C@@H](c2nccs2)O1.
What is the InChIKey of (5S)-5-(1,3-thiazol-2-yl)oxolan-2-one?
The InChIKey is HLKDVGANNOBXFQ-YFKPBYRVSA-N. The full InChI is InChI=1S/C7H7NO2S/c9-6-2-1-5(10-6)7-8-3-4-11-7/h3-5H,1-2H2/t5-/m0/s1.
What are the key properties of (5S)-5-(1,3-thiazol-2-yl)oxolan-2-one?
(5S)-5-(1,3-thiazol-2-yl)oxolan-2-one has a molecular weight of 169.21 g/mol, XLogP of 1.52, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-(1,3-thiazol-2-yl)oxolan-2-one is sourced from PubChem (CID 71354365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).