C10H7N3S — CID 71355949
2-thia-4,9,13-triazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaene (PubChem CID 71355949) has the molecular formula C10H7N3S and a molecular weight of 201.25 g/mol. Its IUPAC name is 2-thia-4,9,13-triazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaene.
| Compound Name | 2-thia-4,9,13-triazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaene |
|---|---|
| PubChem CID | 71355949 |
| Molecular Formula | C10H7N3S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | 2-thia-4,9,13-triazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaene |
| SMILES | c1cnc2c(c1)Nc1ccncc1S2 |
| InChI | InChI=1S/C10H7N3S/c1-2-8-10(12-4-1)14-9-6-11-5-3-7(9)13-8/h1-6,13H |
| InChIKey | IONJPFYIUBPWQZ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |