About butan-2-ylidenehydrazine
butan-2-ylidenehydrazine (PubChem CID 71356052) has the molecular formula C4H10N2
and a molecular weight of 86.14 g/mol. Its IUPAC name is butan-2-ylidenehydrazine.
Molecular Properties
| Compound Name | butan-2-ylidenehydrazine |
| PubChem CID | 71356052 |
| Molecular Formula | C4H10N2 |
| Molecular Weight | 86.14 g/mol |
| Exact Mass | 86.08 |
| IUPAC Name | butan-2-ylidenehydrazine |
| SMILES | CCC(C)=NN |
| InChI | InChI=1S/C4H10N2/c1-3-4(2)6-5/h3,5H2,1-2H3 |
| InChIKey | VPGUBZVWMHRRSS-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 86.14 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze butan-2-ylidenehydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-ylidenehydrazine?
The IUPAC name of butan-2-ylidenehydrazine (CID 71356052) is butan-2-ylidenehydrazine.
What is the SMILES notation for butan-2-ylidenehydrazine?
The canonical SMILES for butan-2-ylidenehydrazine is CCC(C)=NN.
What is the InChIKey of butan-2-ylidenehydrazine?
The InChIKey is VPGUBZVWMHRRSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2/c1-3-4(2)6-5/h3,5H2,1-2H3.
What are the key properties of butan-2-ylidenehydrazine?
butan-2-ylidenehydrazine has a molecular weight of 86.14 g/mol, XLogP of 0.73, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-ylidenehydrazine is sourced from PubChem (CID 71356052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).