C28H22ClO4P — CID 71356057
naphthalen-1-yl(triphenyl)phosphanium perchlorate (PubChem CID 71356057) has the molecular formula C28H22ClO4P and a molecular weight of 488.91 g/mol. Its IUPAC name is naphthalen-1-yl(triphenyl)phosphanium perchlorate.
| Compound Name | naphthalen-1-yl(triphenyl)phosphanium perchlorate |
|---|---|
| PubChem CID | 71356057 |
| Molecular Formula | C28H22ClO4P |
| Molecular Weight | 488.91 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | naphthalen-1-yl(triphenyl)phosphanium perchlorate |
| SMILES | [O-][Cl+3]([O-])([O-])[O-].c1ccc([P+](c2ccccc2)(c2ccccc2)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C28H22P.ClHO4/c1-4-15-24(16-5-1)29(25-17-6-2-7-18-25,26-19-8-3-9-20-26)28-22-12-14-23-13-10-11-21-27(23)28;2-1(3,4)5/h1-22H;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | HAOHCXXBJFLRNS-UHFFFAOYSA-M |
| XLogP | 0.70 |
| TPSA | 92.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.91 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|