About 1-(5-piperidin-1-ium-1-ylidenepenta-1,3-dienyl)piperidine perchlorate
1-(5-piperidin-1-ium-1-ylidenepenta-1,3-dienyl)piperidine perchlorate (PubChem CID 71356627) has the molecular formula C15H25ClN2O4
and a molecular weight of 332.83 g/mol. Its IUPAC name is 1-(5-piperidin-1-ium-1-ylidenepenta-1,3-dienyl)piperidine perchlorate.
Molecular Properties
| Compound Name | 1-(5-piperidin-1-ium-1-ylidenepenta-1,3-dienyl)piperidine perchlorate |
| PubChem CID | 71356627 |
| Molecular Formula | C15H25ClN2O4 |
| Molecular Weight | 332.83 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 1-(5-piperidin-1-ium-1-ylidenepenta-1,3-dienyl)piperidine perchlorate |
| SMILES | C(=CC=[N+]1CCCCC1)C=CN1CCCCC1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C15H25N2.ClHO4/c1-4-10-16(11-5-1)14-8-3-9-15-17-12-6-2-7-13-17;2-1(3,4)5/h3,8-9,14-15H,1-2,4-7,10-13H2;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | LIKQQYQAJKYFAP-UHFFFAOYSA-M |
| XLogP | -1.95 |
| TPSA | 98.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.83 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-piperidin-1-ium-1-ylidenepenta-1,3-dienyl)piperidine perchlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-piperidin-1-ium-1-ylidenepenta-1,3-dienyl)piperidine perchlorate?
The IUPAC name of 1-(5-piperidin-1-ium-1-ylidenepenta-1,3-dienyl)piperidine perchlorate (CID 71356627) is 1-(5-piperidin-1-ium-1-ylidenepenta-1,3-dienyl)piperidine perchlorate.
What is the SMILES notation for 1-(5-piperidin-1-ium-1-ylidenepenta-1,3-dienyl)piperidine perchlorate?
The canonical SMILES for 1-(5-piperidin-1-ium-1-ylidenepenta-1,3-dienyl)piperidine perchlorate is C(=CC=[N+]1CCCCC1)C=CN1CCCCC1.[O-][Cl+3]([O-])([O-])[O-].
What is the InChIKey of 1-(5-piperidin-1-ium-1-ylidenepenta-1,3-dienyl)piperidine perchlorate?
The InChIKey is LIKQQYQAJKYFAP-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H25N2.ClHO4/c1-4-10-16(11-5-1)14-8-3-9-15-17-12-6-2-7-13-17;2-1(3,4)5/h3,8-9,14-15H,1-2,4-7,10-13H2;(H,2,3,4,5)/q+1;/p-1.
What are the key properties of 1-(5-piperidin-1-ium-1-ylidenepenta-1,3-dienyl)piperidine perchlorate?
1-(5-piperidin-1-ium-1-ylidenepenta-1,3-dienyl)piperidine perchlorate has a molecular weight of 332.83 g/mol, XLogP of -1.95, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-piperidin-1-ium-1-ylidenepenta-1,3-dienyl)piperidine perchlorate is sourced from PubChem (CID 71356627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).