About (2-methyl-2-phenylpropyl) 4-bromobenzenesulfonate
(2-methyl-2-phenylpropyl) 4-bromobenzenesulfonate (PubChem CID 71356659) has the molecular formula C16H17BrO3S
and a molecular weight of 369.28 g/mol. Its IUPAC name is (2-methyl-2-phenylpropyl) 4-bromobenzenesulfonate.
Molecular Properties
| Compound Name | (2-methyl-2-phenylpropyl) 4-bromobenzenesulfonate |
| PubChem CID | 71356659 |
| Molecular Formula | C16H17BrO3S |
| Molecular Weight | 369.28 g/mol |
| Exact Mass | 368.01 |
| IUPAC Name | (2-methyl-2-phenylpropyl) 4-bromobenzenesulfonate |
| SMILES | CC(C)(COS(=O)(=O)c1ccc(Br)cc1)c1ccccc1 |
| InChI | InChI=1S/C16H17BrO3S/c1-16(2,13-6-4-3-5-7-13)12-20-21(18,19)15-10-8-14(17)9-11-15/h3-11H,12H2,1-2H3 |
| InChIKey | BSMRWDIUNPIKOL-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.28 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (2-methyl-2-phenylpropyl) 4-bromobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-2-phenylpropyl) 4-bromobenzenesulfonate?
The IUPAC name of (2-methyl-2-phenylpropyl) 4-bromobenzenesulfonate (CID 71356659) is (2-methyl-2-phenylpropyl) 4-bromobenzenesulfonate.
What is the SMILES notation for (2-methyl-2-phenylpropyl) 4-bromobenzenesulfonate?
The canonical SMILES for (2-methyl-2-phenylpropyl) 4-bromobenzenesulfonate is CC(C)(COS(=O)(=O)c1ccc(Br)cc1)c1ccccc1.
What is the InChIKey of (2-methyl-2-phenylpropyl) 4-bromobenzenesulfonate?
The InChIKey is BSMRWDIUNPIKOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17BrO3S/c1-16(2,13-6-4-3-5-7-13)12-20-21(18,19)15-10-8-14(17)9-11-15/h3-11H,12H2,1-2H3.
What are the key properties of (2-methyl-2-phenylpropyl) 4-bromobenzenesulfonate?
(2-methyl-2-phenylpropyl) 4-bromobenzenesulfonate has a molecular weight of 369.28 g/mol, XLogP of 4.13, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-2-phenylpropyl) 4-bromobenzenesulfonate is sourced from PubChem (CID 71356659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).