3-(2-cyclohexyl-1,3-thiazol-4-yl)prop-2-enoic acid

C12H15NO2S — CID 71356714

IUPAC3-(2-cyclohexyl-1,3-thiazol-4-yl)prop-2-enoic acid
SMILESO=C(O)C=Cc1csc(C2CCCCC2)n1
InChIInChI=1S/C12H15NO2S/c14-11(15)7-6-10-8-16-12(13-10)9-4-2-1-3-5-9/h6-9H,1-5H2,(H,14,15)
InChIKeyLBQCHSHMFDPQTE-UHFFFAOYSA-N
MW237.32 g/mol
LogP3.29
Rot. Bonds3

About 3-(2-cyclohexyl-1,3-thiazol-4-yl)prop-2-enoic acid

3-(2-cyclohexyl-1,3-thiazol-4-yl)prop-2-enoic acid (PubChem CID 71356714) has the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. Its IUPAC name is 3-(2-cyclohexyl-1,3-thiazol-4-yl)prop-2-enoic acid.

Molecular Properties

Compound Name3-(2-cyclohexyl-1,3-thiazol-4-yl)prop-2-enoic acid
PubChem CID71356714
Molecular FormulaC12H15NO2S
Molecular Weight237.32 g/mol
Exact Mass237.08
IUPAC Name3-(2-cyclohexyl-1,3-thiazol-4-yl)prop-2-enoic acid
SMILESO=C(O)C=Cc1csc(C2CCCCC2)n1
InChIInChI=1S/C12H15NO2S/c14-11(15)7-6-10-8-16-12(13-10)9-4-2-1-3-5-9/h6-9H,1-5H2,(H,14,15)
InChIKeyLBQCHSHMFDPQTE-UHFFFAOYSA-N
XLogP3.29
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500237.32
LogP ≤ 53.29
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 3-(2-cyclohexyl-1,3-thiazol-4-yl)prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2-cyclohexyl-1,3-thiazol-4-yl)prop-2-enoic acid?
The IUPAC name of 3-(2-cyclohexyl-1,3-thiazol-4-yl)prop-2-enoic acid (CID 71356714) is 3-(2-cyclohexyl-1,3-thiazol-4-yl)prop-2-enoic acid.
What is the SMILES notation for 3-(2-cyclohexyl-1,3-thiazol-4-yl)prop-2-enoic acid?
The canonical SMILES for 3-(2-cyclohexyl-1,3-thiazol-4-yl)prop-2-enoic acid is O=C(O)C=Cc1csc(C2CCCCC2)n1.
What is the InChIKey of 3-(2-cyclohexyl-1,3-thiazol-4-yl)prop-2-enoic acid?
The InChIKey is LBQCHSHMFDPQTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO2S/c14-11(15)7-6-10-8-16-12(13-10)9-4-2-1-3-5-9/h6-9H,1-5H2,(H,14,15).
What are the key properties of 3-(2-cyclohexyl-1,3-thiazol-4-yl)prop-2-enoic acid?
3-(2-cyclohexyl-1,3-thiazol-4-yl)prop-2-enoic acid has a molecular weight of 237.32 g/mol, XLogP of 3.29, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-cyclohexyl-1,3-thiazol-4-yl)prop-2-enoic acid is sourced from PubChem (CID 71356714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).