C26H40 — CID 71356905
1,3,5,8-tetratert-butylnaphthalene (PubChem CID 71356905) has the molecular formula C26H40 and a molecular weight of 352.61 g/mol. Its IUPAC name is 1,3,5,8-tetratert-butylnaphthalene.
| Compound Name | 1,3,5,8-tetratert-butylnaphthalene |
|---|---|
| PubChem CID | 71356905 |
| Molecular Formula | C26H40 |
| Molecular Weight | 352.61 g/mol |
| Exact Mass | 352.31 |
| IUPAC Name | 1,3,5,8-tetratert-butylnaphthalene |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c2c(C(C)(C)C)ccc(C(C)(C)C)c2c1 |
| InChI | InChI=1S/C26H40/c1-23(2,3)17-15-18-19(24(4,5)6)13-14-20(25(7,8)9)22(18)21(16-17)26(10,11)12/h13-16H,1-12H3 |
| InChIKey | DOSBMENIFHJPNU-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.61 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |