C12H14S — CID 71357657
1,2,3,4,4a,5a-hexahydrodibenzothiophene (PubChem CID 71357657) has the molecular formula C12H14S and a molecular weight of 190.31 g/mol. Its IUPAC name is 1,2,3,4,4a,5a-hexahydrodibenzothiophene.
| Compound Name | 1,2,3,4,4a,5a-hexahydrodibenzothiophene |
|---|---|
| PubChem CID | 71357657 |
| Molecular Formula | C12H14S |
| Molecular Weight | 190.31 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | 1,2,3,4,4a,5a-hexahydrodibenzothiophene |
| SMILES | C1=CC2=C3CCCCC3SC2C=C1 |
| InChI | InChI=1S/C12H14S/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h1,3,5,7,11-12H,2,4,6,8H2 |
| InChIKey | WDWCNEBLQHCZHC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |