About 6,10-dimethylundeca-5,9-dienoic acid
6,10-dimethylundeca-5,9-dienoic acid (PubChem CID 71357971) has the molecular formula C13H22O2
and a molecular weight of 210.32 g/mol. Its IUPAC name is 6,10-dimethylundeca-5,9-dienoic acid.
Molecular Properties
| Compound Name | 6,10-dimethylundeca-5,9-dienoic acid |
| PubChem CID | 71357971 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 6,10-dimethylundeca-5,9-dienoic acid |
| SMILES | CC(C)=CCCC(C)=CCCCC(=O)O |
| InChI | InChI=1S/C13H22O2/c1-11(2)7-6-9-12(3)8-4-5-10-13(14)15/h7-8H,4-6,9-10H2,1-3H3,(H,14,15) |
| InChIKey | FCZAQMQDMGPNLN-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6,10-dimethylundeca-5,9-dienoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,10-dimethylundeca-5,9-dienoic acid?
The IUPAC name of 6,10-dimethylundeca-5,9-dienoic acid (CID 71357971) is 6,10-dimethylundeca-5,9-dienoic acid.
What is the SMILES notation for 6,10-dimethylundeca-5,9-dienoic acid?
The canonical SMILES for 6,10-dimethylundeca-5,9-dienoic acid is CC(C)=CCCC(C)=CCCCC(=O)O.
What is the InChIKey of 6,10-dimethylundeca-5,9-dienoic acid?
The InChIKey is FCZAQMQDMGPNLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O2/c1-11(2)7-6-9-12(3)8-4-5-10-13(14)15/h7-8H,4-6,9-10H2,1-3H3,(H,14,15).
What are the key properties of 6,10-dimethylundeca-5,9-dienoic acid?
6,10-dimethylundeca-5,9-dienoic acid has a molecular weight of 210.32 g/mol, XLogP of 3.93, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6,10-dimethylundeca-5,9-dienoic acid is sourced from PubChem (CID 71357971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).