About 4,5-diphenyl-1,3-dithiol-1-ium perchlorate
4,5-diphenyl-1,3-dithiol-1-ium perchlorate (PubChem CID 71357999) has the molecular formula C15H11ClO4S2
and a molecular weight of 354.84 g/mol. Its IUPAC name is 4,5-diphenyl-1,3-dithiol-1-ium perchlorate.
Molecular Properties
| Compound Name | 4,5-diphenyl-1,3-dithiol-1-ium perchlorate |
| PubChem CID | 71357999 |
| Molecular Formula | C15H11ClO4S2 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 353.98 |
| IUPAC Name | 4,5-diphenyl-1,3-dithiol-1-ium perchlorate |
| SMILES | [O-][Cl+3]([O-])([O-])[O-].c1ccc(-c2sc[s+]c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C15H11S2.ClHO4/c1-3-7-12(8-4-1)14-15(17-11-16-14)13-9-5-2-6-10-13;2-1(3,4)5/h1-11H;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | PWBRHXPCUIYBSJ-UHFFFAOYSA-M |
| XLogP | 0.67 |
| TPSA | 92.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 4,5-diphenyl-1,3-dithiol-1-ium perchlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-diphenyl-1,3-dithiol-1-ium perchlorate?
The IUPAC name of 4,5-diphenyl-1,3-dithiol-1-ium perchlorate (CID 71357999) is 4,5-diphenyl-1,3-dithiol-1-ium perchlorate.
What is the SMILES notation for 4,5-diphenyl-1,3-dithiol-1-ium perchlorate?
The canonical SMILES for 4,5-diphenyl-1,3-dithiol-1-ium perchlorate is [O-][Cl+3]([O-])([O-])[O-].c1ccc(-c2sc[s+]c2-c2ccccc2)cc1.
What is the InChIKey of 4,5-diphenyl-1,3-dithiol-1-ium perchlorate?
The InChIKey is PWBRHXPCUIYBSJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H11S2.ClHO4/c1-3-7-12(8-4-1)14-15(17-11-16-14)13-9-5-2-6-10-13;2-1(3,4)5/h1-11H;(H,2,3,4,5)/q+1;/p-1.
What are the key properties of 4,5-diphenyl-1,3-dithiol-1-ium perchlorate?
4,5-diphenyl-1,3-dithiol-1-ium perchlorate has a molecular weight of 354.84 g/mol, XLogP of 0.67, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-diphenyl-1,3-dithiol-1-ium perchlorate is sourced from PubChem (CID 71357999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).