C9H15N3O3 — CID 71358039
1,4,7-trimethyl-1,4,7-triazonane-2,5,8-trione (PubChem CID 71358039) has the molecular formula C9H15N3O3 and a molecular weight of 213.24 g/mol. Its IUPAC name is 1,4,7-trimethyl-1,4,7-triazonane-2,5,8-trione.
| Compound Name | 1,4,7-trimethyl-1,4,7-triazonane-2,5,8-trione |
|---|---|
| PubChem CID | 71358039 |
| Molecular Formula | C9H15N3O3 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | 1,4,7-trimethyl-1,4,7-triazonane-2,5,8-trione |
| SMILES | CN1CC(=O)N(C)CC(=O)N(C)CC1=O |
| InChI | InChI=1S/C9H15N3O3/c1-10-4-8(14)12(3)6-9(15)11(2)5-7(10)13/h4-6H2,1-3H3 |
| InChIKey | NYOMGJJEWQWXHY-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |