About 4,10-diiminoperylene-3,9-diamine
4,10-diiminoperylene-3,9-diamine (PubChem CID 71358286) has the molecular formula C20H14N4
and a molecular weight of 310.36 g/mol. Its IUPAC name is 4,10-diiminoperylene-3,9-diamine.
Molecular Properties
| Compound Name | 4,10-diiminoperylene-3,9-diamine |
| PubChem CID | 71358286 |
| Molecular Formula | C20H14N4 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 4,10-diiminoperylene-3,9-diamine |
| SMILES | [H]/N=c1\ccc2c3ccc(N)c4/c(=N/[H])ccc(c5ccc(N)c1c52)c43 |
| InChI | InChI=1S/C20H14N4/c21-13-5-1-9-10-2-6-15(23)20-16(24)8-4-12(18(10)20)11-3-7-14(22)19(13)17(9)11/h1-8,21,24H,22-23H2/b21-13+,24-16+ |
| InChIKey | DFCGTDGRTLQFAR-XPQJGMKCSA-N |
| XLogP | 3.30 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 4,10-diiminoperylene-3,9-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,10-diiminoperylene-3,9-diamine?
The IUPAC name of 4,10-diiminoperylene-3,9-diamine (CID 71358286) is 4,10-diiminoperylene-3,9-diamine.
What is the SMILES notation for 4,10-diiminoperylene-3,9-diamine?
The canonical SMILES for 4,10-diiminoperylene-3,9-diamine is [H]/N=c1\ccc2c3ccc(N)c4/c(=N/[H])ccc(c5ccc(N)c1c52)c43.
What is the InChIKey of 4,10-diiminoperylene-3,9-diamine?
The InChIKey is DFCGTDGRTLQFAR-XPQJGMKCSA-N. The full InChI is InChI=1S/C20H14N4/c21-13-5-1-9-10-2-6-15(23)20-16(24)8-4-12(18(10)20)11-3-7-14(22)19(13)17(9)11/h1-8,21,24H,22-23H2/b21-13+,24-16+.
What are the key properties of 4,10-diiminoperylene-3,9-diamine?
4,10-diiminoperylene-3,9-diamine has a molecular weight of 310.36 g/mol, XLogP of 3.30, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,10-diiminoperylene-3,9-diamine is sourced from PubChem (CID 71358286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).