About oxidanium;perchlorate;hydrate
oxidanium;perchlorate;hydrate (PubChem CID 71358353) has the molecular formula H5ClO6
and a molecular weight of 136.49 g/mol. Its IUPAC name is oxidanium;perchlorate;hydrate.
Molecular Properties
| Compound Name | oxidanium;perchlorate;hydrate |
| PubChem CID | 71358353 |
| Molecular Formula | H5ClO6 |
| Molecular Weight | 136.49 g/mol |
| Exact Mass | 135.98 |
| IUPAC Name | oxidanium;perchlorate;hydrate |
| SMILES | O.[O-][Cl+3]([O-])([O-])[O-].[OH3+] |
| InChI | InChI=1S/ClHO4.2H2O/c2-1(3,4)5;;/h(H,2,3,4,5);2*1H2 |
| InChIKey | DTSFAVOKEUXEMO-UHFFFAOYSA-N |
| XLogP | -6.50 |
| TPSA | 156.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.49 |
| LogP ≤ 5 | -6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze oxidanium;perchlorate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxidanium;perchlorate;hydrate?
The IUPAC name of oxidanium;perchlorate;hydrate (CID 71358353) is oxidanium;perchlorate;hydrate.
What is the SMILES notation for oxidanium;perchlorate;hydrate?
The canonical SMILES for oxidanium;perchlorate;hydrate is O.[O-][Cl+3]([O-])([O-])[O-].[OH3+].
What is the InChIKey of oxidanium;perchlorate;hydrate?
The InChIKey is DTSFAVOKEUXEMO-UHFFFAOYSA-N. The full InChI is InChI=1S/ClHO4.2H2O/c2-1(3,4)5;;/h(H,2,3,4,5);2*1H2.
What are the key properties of oxidanium;perchlorate;hydrate?
oxidanium;perchlorate;hydrate has a molecular weight of 136.49 g/mol, XLogP of -6.50, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for oxidanium;perchlorate;hydrate is sourced from PubChem (CID 71358353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).